For research use only. Not for therapeutic Use.
2-Pyridineacetamide(Cat No.:L006952), is an organic compound. It is a white solid and a derivative of pyridine, containing an acetamide functional group. This compound is utilized in pharmaceutical and chemical research as a building block in the synthesis of various organic molecules. Its presence in several drug compounds highlights its significance in medicinal chemistry. 2-Pyridineacetamide serves as a valuable intermediate in the development of pharmaceuticals, agrochemicals, and other fine chemicals.
CAS Number | 5451-39-8 |
Molecular Formula | C7H8N2O |
Purity | ≥95% |
IUPAC Name | 2-pyridin-2-ylacetamide |
InChI | InChI=1S/C7H8N2O/c8-7(10)5-6-3-1-2-4-9-6/h1-4H,5H2,(H2,8,10) |
InChIKey | UXVCEKRAZBZVSL-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)CC(=O)N |