For research use only. Not for therapeutic Use.
2-Pyridylacetic-d2 Acid-OD DCl is a deuterated form of 2-pyridylacetic acid, where the hydrogen atoms are replaced with deuterium, and the compound is present as the deuterated acid chloride (DCl) salt. This labeling allows for precise tracking in research, particularly in studies involving metabolic pathways, reaction mechanisms, and compound stability using mass spectrometry and NMR spectroscopy. The deuterium substitution provides a distinct isotopic signature, aiding in detailed analysis and understanding of the compound’s behavior in biochemical and pharmaceutical research.
CAS Number | 1219802-51-3 |
Synonyms | 2-Pyridylacetic–d2 Acid-OD DCl |
Molecular Formula | C7H8ClNO2 |
Purity | ≥95% |
Storage | -20°C |
InChI | InChI=1S/C7H7NO2.ClH/c9-7(10)5-6-3-1-2-4-8-6;/h1-4H,5H2,(H,9,10);1H/i5D2;/hD2 |
InChIKey | MQVISALTZUNQSK-LFWFLCBASA-N |
SMILES | C1=CC=NC(=C1)CC(=O)O.Cl |