For research use only. Not for therapeutic Use.
2-Quinoxalin-2-ylquinoxaline(Cat No.:M085488) is a chemical compound characterized by its fused ring structure containing two quinoxaline units. Quinoxaline itself is a heterocyclic compound, consisting of a fused ring of benzene and pyrazine. The specific structure of 2-quinoxalin-2-ylquinoxaline, with two quinoxaline moieties, suggests it has significant aromatic character and potential electronic properties, making it of interest in materials science, particularly for electronic and photonic applications. Compounds like this are often explored for their conductive properties and stability in various chemical environments, useful in developing advanced materials for electronic devices.
Catalog Number | M085488 |
CAS Number | 27739-37-3 |
Molecular Formula | C16H10N4 |
Purity | ≥95% |
IUPAC Name | 2-quinoxalin-2-ylquinoxaline |
InChI | InChI=1S/C16H10N4/c1-3-7-13-11(5-1)17-9-15(19-13)16-10-18-12-6-2-4-8-14(12)20-16/h1-10H |
InChIKey | DSYFNRZHDYNTTD-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)N=CC(=N2)C3=NC4=CC=CC=C4N=C3 |