For research use only. Not for therapeutic Use.
2-Quinoxalinecarboxaldehyde is a heterocyclic compound featuring a quinoxaline core with a carboxaldehyde group at the 2nd position. This compound is of significant interest in organic synthesis and medicinal chemistry due to the bioactive nature of quinoxaline derivatives, which are often explored for their antimicrobial, anticancer, and anti-inflammatory properties. The reactive aldehyde group allows for further functionalization, making it a valuable intermediate in the preparation of more complex molecules, particularly in the development of pharmaceuticals and agrochemicals.
CAS Number | 1593-08-4 |
Synonyms | 2-Formylquinoxaline; Quinoxalin-2-carboxaldehyde; |
Molecular Formula | C9H6N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | quinoxaline-2-carbaldehyde |
InChI | InChI=1S/C9H6N2O/c12-6-7-5-10-8-3-1-2-4-9(8)11-7/h1-6H |
InChIKey | UJEHWLFUEQHEEZ-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)N=CC(=N2)C=O |