For research use only. Not for therapeutic Use.
2-(R)-Carboethoxy-4-(R)-Hydroxypyrrolidine(CAT: M118278) is a high-purity chiral compound featuring a pyrrolidine ring with (R)-configured carboethoxy and hydroxy functional groups. This versatile molecule is widely utilized in pharmaceutical and chemical research, particularly in the synthesis of complex organic molecules and enantiomerically pure bioactive compounds. Its stereospecific structure makes it valuable in medicinal chemistry for the development of novel therapeutic agents and the exploration of stereoselective reaction pathways. With reliable quality and consistent performance, 2-(R)-Carboethoxy-4-(R)-Hydroxypyrrolidine is an essential reagent for cutting-edge research in drug discovery and synthetic organic chemistry.
CAS Number | 132666-67-2 |
Molecular Formula | C7H13NO3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | ethyl (2R,4R)-4-hydroxypyrrolidine-2-carboxylate |
InChI | InChI=1S/C7H13NO3/c1-2-11-7(10)6-3-5(9)4-8-6/h5-6,8-9H,2-4H2,1H3/t5-,6-/m1/s1 |
InChIKey | JMHQESARJMGVCZ-PHDIDXHHSA-N |
SMILES | CCOC(=O)C1CC(CN1)O |