Home
>
Chemical Reagents>Organic Building Blocks> 2-((tert-Butoxycarbonyl)amino)-2-(3-chlorophenyl)acetic acid
For research use only. Not for therapeutic Use.
2-((tert-Butoxycarbonyl)amino)-2-(3-chlorophenyl)acetic acid(CAT: L024073) is a protected amino acid derivative frequently used in organic synthesis and pharmaceutical research. Its structure features a tert-butoxycarbonyl (Boc) protecting group, an amino functional group, and a 3-chlorophenyl moiety attached to the acetic acid backbone, making it versatile for peptide synthesis and drug development. The Boc group ensures stability during multi-step synthetic processes while enabling selective deprotection when needed. This compound is particularly valuable in designing bioactive molecules and intermediates for structure-activity relationship (SAR) studies. Researchers employ it as a building block in medicinal chemistry to explore therapeutic agents targeting diverse biological pathways.
CAS Number | 669713-92-2 |
Molecular Formula | C13H16ClNO4 |
Purity | ≥95% |
IUPAC Name | 2-(3-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
InChI | InChI=1S/C13H16ClNO4/c1-13(2,3)19-12(18)15-10(11(16)17)8-5-4-6-9(14)7-8/h4-7,10H,1-3H3,(H,15,18)(H,16,17) |
InChIKey | BGMKFLAFNZFBBB-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC(C1=CC(=CC=C1)Cl)C(=O)O |