For research use only. Not for therapeutic Use.
2-(tert-Butyl)-6-nitrophenol (Cat.No:L004163) is a significant chemical compound with versatile applications. Its unique structure, featuring a tert-butyl group and a nitrophenol moiety, imparts distinctive reactivity and properties. This compound finds utility in various industries, including pharmaceuticals, agrochemicals, and dyes. It serves as a key intermediate in the synthesis of specialized organic molecules, highlighting its importance in chemical research and product development.
CAS Number | 18515-04-3 |
Molecular Formula | C10H13NO3 |
Purity | ≥95% |
IUPAC Name | 2-tert-butyl-6-nitrophenol |
InChI | InChI=1S/C10H13NO3/c1-10(2,3)7-5-4-6-8(9(7)12)11(13)14/h4-6,12H,1-3H3 |
InChIKey | GNGBGYYGJIJQGM-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=C(C(=CC=C1)[N+](=O)[O-])O |