For research use only. Not for therapeutic Use.
2-[[(Tetrahydropyran-2-yl)oxy]methyl]benzaldehyde(CAT: L026833) is a benzaldehyde derivative featuring a tetrahydropyranyloxy (THP) protecting group attached to the benzaldehyde’s methyl group. This THP group enhances stability, especially under acidic conditions, allowing the compound to serve as an intermediate in complex organic synthesis without the aldehyde undergoing unwanted reactions. Commonly used as a protected form of benzaldehyde in synthetic chemistry, 2-[[(Tetrahydropyran-2-yl)oxy]methyl]benzaldehyde is useful in multi-step synthesis where functional group protection and deprotection are critical. This compound is frequently employed in the preparation of aromatic intermediates and various drug discovery research applications, facilitating the controlled synthesis of aldehyde-containing compounds.
CAS Number | 99948-47-7 |
Molecular Formula | C13H16O3 |
Purity | ≥95% |
IUPAC Name | 2-(oxan-2-yloxymethyl)benzaldehyde |
InChI | InChI=1S/C13H16O3/c14-9-11-5-1-2-6-12(11)10-16-13-7-3-4-8-15-13/h1-2,5-6,9,13H,3-4,7-8,10H2 |
InChIKey | FEGNADMYWSPCJP-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |