For research use only. Not for therapeutic Use.
2-(Thiophen-2-yl)piperidine (Cat No.:L006151) is an organic compound with potential applications in various fields, particularly in pharmaceutical research. It consists of a piperidine ring with a thiophene group attached at position 2. The combination of a piperidine and thiophene ring in this compound may offer unique chemical properties, making it interesting for drug discovery and medicinal chemistry. Researchers may explore its potential as a building block to synthesize novel compounds with biological activities or pharmacological properties.
CAS Number | 270902-38-0 |
Molecular Formula | C9H13NS |
Purity | ≥95% |
IUPAC Name | 2-thiophen-2-ylpiperidine |
InChI | InChI=1S/C9H13NS/c1-2-6-10-8(4-1)9-5-3-7-11-9/h3,5,7-8,10H,1-2,4,6H2 |
InChIKey | IRHBPLJGCWXMPV-UHFFFAOYSA-N |
SMILES | C1CCNC(C1)C2=CC=CS2 |