For research use only. Not for therapeutic Use.
2-(Thiophen-2-yl)pyridin-4-amine(Cat No.:L007552), is a chemical compound featuring a pyridine ring substituted with an amino group at the 4th position and a thiophen-2-yl group at the 2nd position. This compound is valuable in organic synthesis and medicinal chemistry, often employed as a key intermediate for creating diverse organic molecules, including pharmaceuticals and agrochemicals. Its unique structure and reactivity allow for various chemical transformations, making it significant in the design and development of complex organic compounds.
Catalog Number | L007552 |
CAS Number | 1020540-64-0 |
Molecular Formula | C9H8N2S |
Purity | ≥95% |
IUPAC Name | 2-thiophen-2-ylpyridin-4-amine |
InChI | InChI=1S/C9H8N2S/c10-7-3-4-11-8(6-7)9-2-1-5-12-9/h1-6H,(H2,10,11) |
InChIKey | VICUIVSXQWOMQG-UHFFFAOYSA-N |
SMILES | C1=CSC(=C1)C2=NC=CC(=C2)N |