For research use only. Not for therapeutic Use.
2-Thioxo-2,3-dihydropyrazolo[1,5-a][1,3,5]triazin-4(1H)-one(CAT: L043729) is a heterocyclic compound containing both pyrazole and triazine rings, with a thioxo group (-C=S) at the 2-position and a keto group (-C=O) at the 4-position. The unique structure of this compound makes it an interesting scaffold for medicinal chemistry and drug discovery, where it may act as a potential inhibitor of enzymes or receptors. The presence of both sulfur and oxygen atoms in its functional groups allows for versatile interactions with biological targets, often contributing to bioactivity in antimicrobial, anticancer, or anti-inflammatory research. Additionally, its heterocyclic framework makes it useful in the synthesis of other complex organic molecules.
CAS Number | 34682-99-0 |
Molecular Formula | C5H4N4OS |
Purity | ≥95% |
IUPAC Name | 2-sulfanylidene-6H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
InChI | InChI=1S/C5H4N4OS/c10-5-8-4(11)7-3-1-2-6-9(3)5/h1-2,6H,(H,8,10,11) |
InChIKey | YSSDVMSKYUWULF-UHFFFAOYSA-N |
SMILES | C1=CNN2C1=NC(=S)NC2=O |