Home
>
Reference Standards>Heterocyclic Building Blocks> 2-(trans-4-Hydroxycyclohexyl)-1H-isoindole-1,3(2H)-dione
For research use only. Not for therapeutic Use.
2-(trans-4-Hydroxycyclohexyl)-1H-isoindole-1,3(2H)-dione is a compound characterized by its isoindole structure and a hydroxycyclohexyl substituent. This compound is of interest in medicinal chemistry due to its potential therapeutic applications, particularly in the development of novel pharmaceuticals. Its unique structural features may contribute to interactions with biological targets, influencing various biochemical pathways. Researchers investigate its properties for potential use in treating conditions related to inflammation or neurodegenerative diseases, highlighting its significance in the search for effective therapeutic agents.
CAS Number | 99337-98-1 |
Synonyms | 2-(trans-4-Hydroxycyclohexyl)-1H-isoindole-1,3(2H)-dione; 2-(trans-4-Hydroxycyclohexyl)isoindole-1,3-dione; trans-2-(4-Hydroxycyclohexyl)-1H-isoindole-1,3(2H)-dione; trans-2-(4-Hydroxycyclohexyl)isoindoline-1,3-dione; trans-N-(4-Hydroxycyclohexyl)pht |
Molecular Formula | C14H15NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(4-hydroxycyclohexyl)isoindole-1,3-dione |
InChI | InChI=1S/C14H15NO3/c16-10-7-5-9(6-8-10)15-13(17)11-3-1-2-4-12(11)14(15)18/h1-4,9-10,16H,5-8H2 |
InChIKey | YLHCMDNAKVPTIO-UHFFFAOYSA-N |
SMILES | C1CC(CCC1N2C(=O)C3=CC=CC=C3C2=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |