For research use only. Not for therapeutic Use.
2-(Tributylstannyl)pyridine (Cat No.:M080914) is a chemical compound with the molecular formula C21H36N2Sn. It consists of a pyridine ring substituted with a tributylstannyl group. This compound is significant in organic synthesis and chemical research as a reagent and building block in cross-coupling reactions, specifically in Stille couplings. The tributylstannyl group is used as a leaving group, allowing for the formation of carbon-carbon bonds between organotin compounds and organic halides. 2-(Tributylstannyl)pyridine’s role in facilitating selective and controlled coupling reactions contributes to its importance in the synthesis of complex molecules for various applications, including pharmaceuticals and materials science.
| Catalog Number | M080914 |
| CAS Number | 17997-47-6 |
| Molecular Formula | C17H31NSn |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | tributyl(pyridin-2-yl)stannane |
| InChI | InChI=1S/C5H4N.3C4H9.Sn/c1-2-4-6-5-3-1;3*1-3-4-2;/h1-4H;3*1,3-4H2,2H3; |
| InChIKey | GYUURHMITDQTRU-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=CC=CC=N1 |
