For research use only. Not for therapeutic Use.
2-(Trifluoroacetyl)-4-chloroaniline, Hydrochloride Hydrate(CAT: R005837) is a chemical compound with versatile applications, particularly in pharmaceutical research and development. This compound features a trifluoroacetyl group and a chloroaniline moiety and exists in a hydrate form. It serves as a valuable building block and intermediate in the synthesis of complex organic molecules.
| Catalog Number | R005837 |
| CAS Number | 173676-59-0 |
| Synonyms | 1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoro-ethanone Hydrochloride Hydrate;?4-Chloro-2-(trifluoroacetyl)aniline Hydrochloride Hydrate; |
| Molecular Formula | C8H8Cl2F3NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone;hydrate;hydrochloride |
| InChI | InChI=1S/C8H5ClF3NO.ClH.H2O/c9-4-1-2-6(13)5(3-4)7(14)8(10,11)12;;/h1-3H,13H2;1H;1H2 |
| InChIKey | FUYMYLYDBVWEHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)C(F)(F)F)N.O.Cl |
