For research use only. Not for therapeutic Use.
2-(Trifluoromethoxy)benzoic acid(CAT: M119404) is a fluorinated aromatic acid commonly used in organic synthesis, particularly in medicinal chemistry. The trifluoromethoxy group imparts increased lipophilicity and metabolic stability, while also modulating the compound’s electronic properties, making it favorable for use in drug design. The carboxylic acid functionality allows it to participate in esterification and amidation reactions, facilitating the synthesis of pharmaceutical intermediates and agrochemicals. Its unique structure and reactivity make 2-(Trifluoromethoxy)benzoic acid a valuable building block for creating bioactive compounds, offering enhanced binding affinity and stability in high-precision research applications.
CAS Number | 1979-29-9 |
Molecular Formula | C8H5F3O3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-(trifluoromethoxy)benzoic acid |
InChI | InChI=1S/C8H5F3O3/c9-8(10,11)14-6-4-2-1-3-5(6)7(12)13/h1-4H,(H,12,13) |
InChIKey | JMYSPFGUBNENSE-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C(=O)O)OC(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |