For research use only. Not for therapeutic Use.
2-(Trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-ol(Cat No.:L013066)is a high-purity heterocyclic compound widely utilized in pharmaceutical research and drug discovery. Featuring a trifluoromethyl group at the 2-position and a hydroxyl group at the 4-position, this pyrazolo[1,5-a]pyrazine derivative plays a crucial role in the synthesis of bioactive molecules, particularly in the development of kinase inhibitors and other therapeutic agents. Its unique structural properties enable specific interactions within biological systems, making it a valuable reagent for medicinal chemistry. 2-(Trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-ol ensures consistent performance in complex synthetic processes.
CAS Number | 877402-82-9 |
Molecular Formula | C7H4F3N3O |
Purity | ≥95% |
IUPAC Name | 2-(trifluoromethyl)-5H-pyrazolo[1,5-a]pyrazin-4-one |
InChI | InChI=1S/C7H4F3N3O/c8-7(9,10)5-3-4-6(14)11-1-2-13(4)12-5/h1-3H,(H,11,14) |
InChIKey | PLEQTMITFTVUCP-UHFFFAOYSA-N |
SMILES | C1=CN2C(=CC(=N2)C(F)(F)F)C(=O)N1 |