For research use only. Not for therapeutic Use.
20-Deoxyingenol（Cat No.:I004014） is a diterpene compound derived from the root of Euphorbia kansui. It has been found to possess the ability to induce autophagy, a cellular process involved in recycling damaged components and maintaining cellular homeostasis. 20-Deoxyingenol promotes autophagy and enhances lysosomal biogenesis by facilitating the nuclear translocation of transcription factor EB (TFEB), a key regulator of autophagy and lysosomal function.
| Catalog Number | I004014 |
| CAS Number | 54706-99-9 |
| Molecular Formula | C20H28O4 |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (1S,4S,5S,6R,9S,10R,12R,14R)-4,5,6-trihydroxy-3,7,11,11,14-pentamethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
| InChI | InChI=1S/C20H28O4/c1-9-6-12-14-13(18(14,4)5)7-11(3)19(17(12)23)8-10(2)16(22)20(19,24)15(9)21/h6,8,11-16,21-22,24H,7H2,1-5H3/t11-,12+,13-,14+,15-,16+,19+,20+/m1/s1 |
| InChIKey | FOSYZKSOJUQLTD-NHPMXQBPSA-N |
| SMILES | CC1CC2C(C2(C)C)C3C=C(C(C4(C1(C3=O)C=C(C4O)C)O)O)C |
| Reference | <p style=/line-height:25px/> |
