For research use only. Not for therapeutic Use.
20-Hydroxyecdysone(Cat No.:R016187) (20E) is a naturally occurring ecdysteroid hormone found in plants and arthropods, particularly insects, where it plays a crucial role in regulating molting and metamorphosis. In plants, it serves as a defense compound against herbivores. 20-Hydroxyecdysone has gained attention in the field of health and fitness due to its anabolic properties, promoting muscle growth and enhancing physical performance without the androgenic side effects associated with steroids. It is also studied for its potential benefits in improving metabolism, reducing inflammation, and offering protection against certain diseases. Its wide range of biological activities makes it a promising compound in both agriculture and medicine.
CAS Number | 5289-74-7 |
Synonyms | Ecdysterone;Isoinokosterone |
Molecular Formula | C27H44O7 |
Purity | ≥95% |
Target | Autophagy |
Storage | 3 years -20C powder |
IUPAC Name | (2S,3R,5R,9R,10R,13R,14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
InChI | InChI=1S/C27H44O7/c1-23(2,32)9-8-22(31)26(5,33)21-7-11-27(34)16-12-18(28)17-13-19(29)20(30)14-24(17,3)15(16)6-10-25(21,27)4/h12,15,17,19-22,29-34H,6-11,13-14H2,1-5H3/t15-,17-,19+,20-,21-,22+,24+,25+,26+,27+/m0/s1 |
InChIKey | NKDFYOWSKOHCCO-YPVLXUMRSA-N |
SMILES | C[C@]12CC[C@H]3C(=CC(=O)[C@H]4[C@@]3(C[C@@H]([C@@H](C4)O)O)C)[C@@]1(CC[C@@H]2[C@](C)([C@@H](CCC(C)(C)O)O)O)O |