For research use only. Not for therapeutic Use.
20S Proteasome Activator 1 (Cat No.:I043334) is a regulatory protein that enhances the activity of the 20S proteasome, a key component of the proteasomal degradation pathway. The proteasome is responsible for degrading damaged or unneeded proteins, maintaining cellular homeostasis. PA28α binds to the 20S proteasome, facilitating the entry of substrates into the catalytic core, thereby increasing proteasomal activity and efficiency. It plays a crucial role in immune response, protein turnover, and stress responses. PA28α is studied for its potential therapeutic applications in cancer, neurodegenerative diseases, and immune modulation.
| CAS Number | 2761578-18-9 |
| Synonyms | 3-(2-chlorophenothiazin-10-yl)-N,N-bis(4-fluorophenyl)propanamide |
| Molecular Formula | C27H19ClF2N2OS |
| Purity | ≥95% |
| IUPAC Name | 3-(2-chlorophenothiazin-10-yl)-N,N-bis(4-fluorophenyl)propanamide |
| InChI | InChI=1S/C27H19ClF2N2OS/c28-18-5-14-26-24(17-18)31(23-3-1-2-4-25(23)34-26)16-15-27(33)32(21-10-6-19(29)7-11-21)22-12-8-20(30)9-13-22/h1-14,17H,15-16H2 |
| InChIKey | ZFFNQHQEQWDWBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=C(S2)C=CC(=C3)Cl)CCC(=O)N(C4=CC=C(C=C4)F)C5=CC=C(C=C5)F |
