For research use only. Not for therapeutic Use.
21-Deoxy Cortisone(Cat No.:R050218)is a synthetic steroid derivative of cortisone, characterized by the absence of a hydroxyl group at the 21-position. This compound is significant in pharmaceutical research, particularly in the study of glucocorticoid activity and the development of corticosteroid medications. Its structural similarity to cortisone allows it to serve as a useful intermediate in the synthesis of other steroidal compounds. By modifying the structure, researchers can explore the biological activity and therapeutic potential of related compounds, making it valuable in drug development and medicinal chemistry.
CAS Number | 1882-82-2 |
Synonyms | 17-Hydroxypregn-4-ene-3,11,20-trione; 17α-Hydroxy-11-oxoprogesterone; 17α-Hydroxypregn-4-ene-3,11,20-trione; 21-Desoxycortisone; 4-Pregnene-17α-ol-3,11,20-trione; 6-Pregn-4-en-17α-ol-3,11,20-trione; NSC 38722; |
Molecular Formula | C21H28O4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (8S,9S,10R,13S,14S,17R)-17-acetyl-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione |
InChI | InChI=1S/C21H28O4/c1-12(22)21(25)9-7-16-15-5-4-13-10-14(23)6-8-19(13,2)18(15)17(24)11-20(16,21)3/h10,15-16,18,25H,4-9,11H2,1-3H3/t15-,16-,18+,19-,20-,21-/m0/s1 |
InChIKey | PUKLDDOGISCFCP-JSQCKWNTSA-N |
SMILES | CC(=O)C1(CCC2C1(CC(=O)C3C2CCC4=CC(=O)CCC34C)C)O |