For research use only. Not for therapeutic Use.
2,2′-[(1-methylethylidene)bis(4,1-phenyleneoxy)]bisethyl diacetate(Cat No.:M078457) is a chemical compound with notable applications in various industries, including pharmaceuticals and materials science. Its molecular structure consists of two ethyl groups linked to a central core of phenylene rings connected by oxygen atoms. The “diacetate” designation indicates the presence of two acetate groups. This compound’s synthesis often involves reactions between appropriate precursors under controlled conditions. Its properties make it valuable for forming complex structures or as a building block for more intricate molecules, contributing to advancements in drug development and material engineering.
CAS Number | 19224-29-4 |
Molecular Formula | C23H28O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[4-[2-[4-(2-acetyloxyethoxy)phenyl]propan-2-yl]phenoxy]ethyl acetate |
InChI | InChI=1S/C23H28O6/c1-17(24)26-13-15-28-21-9-5-19(6-10-21)23(3,4)20-7-11-22(12-8-20)29-16-14-27-18(2)25/h5-12H,13-16H2,1-4H3 |
InChIKey | HBDPNIKSHRQAJF-UHFFFAOYSA-N |
SMILES | CC(=O)OCCOC1=CC=C(C=C1)C(C)(C)C2=CC=C(C=C2)OCCOC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |