For research use only. Not for therapeutic Use.
2,2′-Azobis(4-methoxy-2,4-dimethylvaleronitrile)(Cat No.:M078604) is a chemical compound commonly abbreviated as AIBN. It’s a white to slightly yellowish crystalline powder. AIBN is primarily used as a radical initiator in the production of polymers, particularly in the formation of acrylic resins and elastomers. Upon heating, it decomposes into free radicals, initiating polymerization reactions. Its relatively low decomposition temperature and compatibility with various monomers make it a versatile initiator in polymer chemistry, facilitating the synthesis of materials used in coatings, adhesives, and other industrial applications.
CAS Number | 15545-97-8 |
Molecular Formula | C16H28N4O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[(2-cyano-4-methoxy-4-methylpentan-2-yl)diazenyl]-4-methoxy-2,4-dimethylpentanenitrile |
InChI | InChI=1S/C16H28N4O2/c1-13(2,21-7)9-15(5,11-17)19-20-16(6,12-18)10-14(3,4)22-8/h9-10H2,1-8H3 |
InChIKey | PFHOSZAOXCYAGJ-UHFFFAOYSA-N |
SMILES | CC(C)(CC(C)(C#N)N=NC(C)(CC(C)(C)OC)C#N)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |