For research use only. Not for therapeutic Use.
2,2-Bis(4-hydroxyphenyl)hexafluoropropane, commonly known as bisphenol AF (BPAF), is an aromatic compound used in the production of certain polymers, particularly in the manufacture of high-performance plastics and resins. Its unique structure, containing two hydroxyphenyl groups and a hexafluoropropane bridge, contributes to its thermal stability and resistance to chemical degradation, making it suitable for various industrial applications.
Catalog Number | R042077 |
CAS Number | 1478-61-1 |
Synonyms | 4,4’-[2,2,2-Trifluoro-1-(trifluoromethyl)ethylidene]bisphenol; 4,4’-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]di-phenol; 4,4’-[Trifluoro-1-(trifluoromethyl)ethylidene]diphenol; 1,1,1,3,3,3-Hexafluoro-2,2-bis(4-hydroxyphenyl)propane; 2,2-(4-Hydro |
Molecular Formula | C15H10F6O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol |
InChI | InChI=1S/C15H10F6O2/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10/h1-8,22-23H |
InChIKey | ZFVMWEVVKGLCIJ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)O)(C(F)(F)F)C(F)(F)F)O |