For research use only. Not for therapeutic Use.
2,2-Bis-(trimethylsilyl)dithiane is a versatile reagent used extensively in organic synthesis and chemical research. Known for its role as a protecting group for carbonyl compounds, it is essential in various synthetic pathways to stabilize reactive intermediates. This compound’s high purity ensures reliable and consistent results in experimental procedures. Its applications extend to the development of complex molecules in pharmaceuticals and agrochemicals, making 2,2-bis-(trimethylsilyl)dithiane a valuable tool in advanced synthetic chemistry and innovative product development.
CAS Number | 13411-46-6 |
Molecular Formula | C10H24S2Si2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | trimethyl-(2-trimethylsilyl-1,3-dithian-2-yl)silane |
InChI | InChI=1S/C10H24S2Si2/c1-13(2,3)10(14(4,5)6)11-8-7-9-12-10/h7-9H2,1-6H3 |
InChIKey | PYMKPNBNDUHBJG-UHFFFAOYSA-N |
SMILES | C[Si](C)(C)C1(SCCCS1)[Si](C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |