For research use only. Not for therapeutic Use.
2,2-Bis({[3-(2-methylaziridin-1-yl)propanoyl]oxy}propanoyl)peroxybis(propan-2-yl)peroxide(Cat No.:L007178), is a complex chemical compound used as a polymerization initiator in the production of various polymers. It is employed in the preparation of crosslinked polymers, such as rubbers and plastics, due to its ability to initiate radical polymerization processes. The compound contains multiple aziridine and peroxide groups, making it highly reactive in initiating polymer chain reactions. Its application in polymer chemistry contributes significantly to the manufacturing of a wide range of materials, including elastomers and thermosetting plastics, in industries such as automotive, aerospace, and electronics.
CAS Number | 64265-57-2 |
Molecular Formula | C24H41N3O6 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2,2-bis[3-(2-methylaziridin-1-yl)propanoyloxymethyl]butyl 3-(2-methylaziridin-1-yl)propanoate |
InChI | InChI=1S/C24H41N3O6/c1-5-24(15-31-21(28)6-9-25-12-18(25)2,16-32-22(29)7-10-26-13-19(26)3)17-33-23(30)8-11-27-14-20(27)4/h18-20H,5-17H2,1-4H3 |
InChIKey | YKEGOEUSKXVSPN-UHFFFAOYSA-N |
SMILES | CCC(COC(=O)CCN1CC1C)(COC(=O)CCN2CC2C)OC(=O)CCN3CC3C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |