For research use only. Not for therapeutic Use.
2,2′-Bithiazole(CAT: L000435) is a versatile compound used in pharmaceutical, organic, and material chemistry. In pharmaceuticals, it has found application as a key intermediate in the synthesis of various bioactive compounds due to its unique structural features, enhancing drug development. In the realm of organic chemistry, 2,2′-Bithiazole serves as a building block for the creation of complex organic molecules, offering valuable versatility.
CAS Number | 13816-21-2 |
Molecular Formula | C6H4N2S2 |
Purity | ≥95% |
IUPAC Name | 2-(1,3-thiazol-2-yl)-1,3-thiazole |
InChI | InChI=1S/C6H4N2S2/c1-3-9-5(7-1)6-8-2-4-10-6/h1-4H |
InChIKey | SMSLWFZHCONMGQ-UHFFFAOYSA-N |