For research use only, not for therapeutic use.
2,2′-Bithiazole(CAT: L000435) is a versatile compound used in pharmaceutical, organic, and material chemistry. In pharmaceuticals, it has found application as a key intermediate in the synthesis of various bioactive compounds due to its unique structural features, enhancing drug development. In the realm of organic chemistry, 2,2′-Bithiazole serves as a building block for the creation of complex organic molecules, offering valuable versatility.
| Catalog Number | L000435 |
| CAS Number | 13816-21-2 |
| Molecular Formula | C6H4N2S2 |
| Purity | ≥95% |
| IUPAC Name | 2-(1,3-thiazol-2-yl)-1,3-thiazole |
| InChI | InChI=1S/C6H4N2S2/c1-3-9-5(7-1)6-8-2-4-10-6/h1-4H |
| InChIKey | SMSLWFZHCONMGQ-UHFFFAOYSA-N |
