For research use only. Not for therapeutic Use.
22-Dehydroclerosterol (Cat No.:R012489) is a chemical compound. It is a derivative of cholesterol, a sterol that plays a crucial role in various biological processes. 22-Dehydroclerosterol lacks a hydrogen atom at position 22 and is often used in the study of cholesterol metabolism and biosynthesis. This compound’s modified structure contributes to understanding the roles of specific functional groups in cholesterol’s biological activity. Its utilization in research supports investigations into the functions and mechanisms of cholesterol-related pathways, furthering knowledge in the fields of biochemistry, metabolism, and medical research.
CAS Number | 26315-07-1 |
Molecular Formula | C29H46O |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,3E,5S)-5-ethyl-6-methylhepta-3,6-dien-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
InChI | InChI=1S/C29H46O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-10,20-21,23-27,30H,2,7,11-18H2,1,3-6H3/b9-8+/t20-,21+,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
InChIKey | ZTJFINKUHDHOSM-KEJCWXRGSA-N |
SMILES | CCC(C=CC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)C(=C)C |