2,2-Dichloroacetic Acid-1-13C (Cat No.:C000849) is a labeled form of 2,2-dichloroacetic acid, an organic compound used in chemical research and as a potential drug candidate. The “1-13C” notation indicates that the carbon atom in the carboxylic acid group is replaced with the stable isotope carbon-13. This labeling allows for precise isotope tracking and quantification in research and analytical applications. 2,2-Dichloroacetic Acid-1-13C serves as a valuable tool in studying metabolic pathways, drug metabolism, and the mode of action of 2,2-dichloroacetic acid and its derivatives, contributing to advancements in pharmaceutical and biochemical research.
| Catalog Number | C000849 |
| CAS Number | 173470-70-7 |
| Molecular Formula | C¹³CH₂Cl₂O₂ |
| Purity | 95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Storage | -20°C, Inert atmosphere, Light sensitive |
| IUPAC Name | 2,2-dichloroacetic acid |
| InChI | InChI=1S/C2H2Cl2O2/c3-1(4)2(5)6/h1H,(H,5,6)/i2+1 |
| InChIKey | JXTHNDFMNIQAHM-VQEHIDDOSA-N |
| SMILES | C(C(=O)O)(Cl)Cl |
