For research use only. Not for therapeutic Use.
2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid(CAT: M107028) is a high-purity fluorinated aromatic compound widely used in pharmaceutical research and organic synthesis. Featuring a benzodioxole core with two strategically placed fluorine atoms and a carboxylic acid group, it serves as a critical intermediate for the development of bioactive molecules, small-molecule inhibitors, and fluorine-containing drug candidates. Its unique structure enhances metabolic stability and bioavailability, making it valuable in medicinal chemistry and agrochemical synthesis. 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid offers excellent chemical stability and reactivity, supporting precision synthesis in both academic and industrial research applications.
CAS Number | 126120-85-2 |
Molecular Formula | C8H4F2O4 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 2,2-difluoro-1,3-benzodioxole-4-carboxylic acid |
InChI | InChI=1S/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12) |
InChIKey | ZGAQVJDFFVTWJK-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)C(=O)O |