For research use only. Not for therapeutic Use.
2,2-Difluoro-1,3-benzodioxole(CAT: R021117) is a chemical compound with applications primarily in organic and synthetic chemistry. This compound is used as a building block or intermediate in the synthesis of more complex molecules. Its significance in organic chemistry lies in its role as a versatile starting material for creating various aromatic compounds and heterocyclic structures.
CAS Number | 1583-59-1 |
Synonyms | 1,2-[(Difluoromethylene)dioxy]benzene; 2,2-Difluoro-1,3-benzodioxole; 2,2-Difluorobenzodioxole |
Molecular Formula | C7H4F2O2 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 2,2-difluoro-1,3-benzodioxole |
InChI | InChI=1S/C7H4F2O2/c8-7(9)10-5-3-1-2-4-6(5)11-7/h1-4H |
InChIKey | DGCOGZQDAXUUBY-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)OC(O2)(F)F |