Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2,2-Dimethyl-1-(2-methylquinolin-6-yl)propan-1-one
For research use only. Not for therapeutic Use.
2,2-Dimethyl-1-(2-methylquinolin-6-yl)propan-1-one (Cat.No:L004039) is a significant chemical compound in pharmaceutical research. Its distinct structure, featuring a quinoline moiety, imparts unique pharmacological potential. This compound serves as a valuable scaffold in the development of bioactive molecules, particularly in the field of drug discovery.
CAS Number | 1534944-10-9 |
Molecular Formula | C15H17NO |
Purity | ≥95% |
IUPAC Name | 2,2-dimethyl-1-(2-methylquinolin-6-yl)propan-1-one |
InChI | InChI=1S/C15H17NO/c1-10-5-6-11-9-12(7-8-13(11)16-10)14(17)15(2,3)4/h5-9H,1-4H3 |
InChIKey | CAEBUXHJRJLFCJ-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(C=C1)C=C(C=C2)C(=O)C(C)(C)C |