For research use only. Not for therapeutic Use.
2,2′-Dipicolylamine is an organic compound consisting of two picolylamine (pyridine-2-carbaldehyde amine) groups linked by a central methylene (-CH₂-) bridge. The pyridine rings provide basic nitrogen atoms, while the dipicolylamine structure offers versatility in coordination chemistry, making it valuable for creating metal complexes. It is widely used in research for developing chelating agents, sensors, and catalysts. Its potential applications extend to areas like bioinorganic chemistry, environmental monitoring, and material science, as well as for pharmaceutical and agricultural purposes.
| Catalog Number | M050539 |
| CAS Number | 1539-42-0 |
| Molecular Formula | C12H13N3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine |
| InChI | InChI=1S/C12H13N3/c1-3-7-14-11(5-1)9-13-10-12-6-2-4-8-15-12/h1-8,13H,9-10H2 |
| InChIKey | KXZQYLBVMZGIKC-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNCC2=CC=CC=N2 |
