For research use only. Not for therapeutic Use.
2,2′-Dithiobis(5-nitropyridine)（Cat No.:L017857）is a key reagent in organic synthesis and pharmaceutical research, particularly useful for its ability to form disulfide linkages. With two nitropyridine rings connected by a disulfide bond, it plays a significant role in thiol-disulfide exchange reactions, making it valuable in the modification of proteins and peptides. Its nitro groups enhance its reactivity, allowing for further functionalization in chemical processes. This compound is widely utilized in the development of bioactive molecules, biochemical assays, and drug discovery, contributing to the synthesis of complex therapeutic agents.
| CAS Number | 2127-10-8 |
| Molecular Formula | C10H6N4O4S2 |
| Purity | ≥95% |
| IUPAC Name | 5-nitro-2-[(5-nitropyridin-2-yl)disulfanyl]pyridine |
| InChI | InChI=1S/C10H6N4O4S2/c15-13(16)7-1-3-9(11-5-7)19-20-10-4-2-8(6-12-10)14(17)18/h1-6H |
| InChIKey | ROUFCTKIILEETD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])SSC2=NC=C(C=C2)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
