For research use only. Not for therapeutic Use.
2,2′-Iminodibenzoic acid(Cat No.:L017856)is a specialized compound used in pharmaceutical research and organic synthesis. Featuring an imino group connecting two benzoic acid moieties, this compound is valuable for developing various bioactive molecules, including potential therapeutic agents. Its unique structure allows for selective reactivity and the formation of complex heterocyclic compounds. High purity and stability make it a crucial intermediate in advanced medicinal chemistry and material science research, supporting the discovery and synthesis of innovative drugs, polymers, and fine chemicals.
CAS Number | 579-92-0 |
Molecular Formula | C14H11NO4 |
Purity | ≥95% |
IUPAC Name | 2-(2-carboxyanilino)benzoic acid |
InChI | InChI=1S/C14H11NO4/c16-13(17)9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14(18)19/h1-8,15H,(H,16,17)(H,18,19) |
InChIKey | ZFRNOTZQUGWMQN-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=CC=CC=C2C(=O)O |