For research use only. Not for therapeutic Use.
2,2′-(Octylimino) bioethanol(Cat No.:M081427), also known as N, N’-bis(2-hydroxyethyl) octyl amine, is a chemical compound used primarily as a corrosion inhibitor and a surfactant. This substance is characterized by two ethanol groups attached to an octyl-imine linkage, making it particularly effective in binding to metal surfaces to prevent corrosion. It is commonly found in various industrial applications, including in coolants and lubricants, where it helps to extend the lifespan of machinery by reducing wear and tear from corrosion. Its dual hydroxyethyl groups also enhance its solubility in water, making it suitable for aqueous systems.
CAS Number | 15520-05-5 |
Molecular Formula | C12H27NO2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-[2-hydroxyethyl(octyl)amino]ethanol |
InChI | InChI=1S/C12H27NO2/c1-2-3-4-5-6-7-8-13(9-11-14)10-12-15/h14-15H,2-12H2,1H3 |
InChIKey | QZQNMMLYACBCMJ-UHFFFAOYSA-N |
SMILES | CCCCCCCCN(CCO)CCO |