For research use only. Not for therapeutic Use.
2,2′-Oxybis(nitrobenzene)(Cat No.:L016686), also known as o-nitrodiphenyl ether, is an aromatic compound featuring two nitrobenzene units connected by an oxygen atom. This compound is used as an intermediate in the synthesis of dyes, pharmaceuticals, and other organic materials. The nitro groups provide reactivity, allowing for further chemical modifications, while the ether linkage contributes to the compound’s stability. It is often employed in the development of advanced materials and in the production of specialty chemicals, making it a valuable building block in both industrial and research settings.
CAS Number | 2217-65-4 |
Molecular Formula | C12H8N2O5 |
Purity | ≥95% |
IUPAC Name | 1-nitro-2-(2-nitrophenoxy)benzene |
InChI | InChI=1S/C12H8N2O5/c15-13(16)9-5-1-3-7-11(9)19-12-8-4-2-6-10(12)14(17)18/h1-8H |
InChIKey | XVIRIXVOLLJIPF-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC2=CC=CC=C2[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |