For research use only. Not for therapeutic Use.
2,2′-Pyridil (CAT: L000175) is a chemical compound with applications in organic chemistry. It serves as a building block for the synthesis of various organic molecules and intermediates. In organic chemistry, 2,2′-pyridil is valuable for creating compounds with different functionalities. Its specific applications may vary depending on the reactions it’s involved in and the target molecules being synthesized.
CAS Number | 492-73-9 |
Molecular Formula | C12H8N2O2 |
Purity | ≥95% |
IUPAC Name | 1,2-dipyridin-2-ylethane-1,2-dione |
InChI | InChI=1S/C12H8N2O2/c15-11(9-5-1-3-7-13-9)12(16)10-6-2-4-8-14-10/h1-8H |
InChIKey | PIINXYKJQGMIOZ-UHFFFAOYSA-N |