For research use only. Not for therapeutic Use.
2,2′-Sulfinyldiethanol (Cat No.:C000894) is a chemical compound with a sulfinyl group (-SO-) and two hydroxyl groups (-OH) attached to the ethane backbone. It is also known as ethane-1,2-diylbis(sulfanyl) ethanol. This compound is used in organic synthesis as a reagent or intermediate for various chemical processes. Its sulfinyl group makes it a useful building block in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals. As with any chemical, safe handling and proper storage are essential to prevent potential hazards. The compound’s unique structural features offer opportunities for diverse applications in the field of chemical research and development.
| Catalog Number | C000894 |
| CAS Number | 3085-45-8 |
| Synonyms | 2,2′-Sulfinylbis[ethanol]; Bis(2-hydroxyethyl) Sulfoxide; Di(2-hydroxyethyl) Sulfoxide; |
| Molecular Formula | C₄H₁₀O₃S |
| Purity | ≥95% |
| Solubility | Methanol (Slightly), Water (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C, Inert atmosphere |
| IUPAC Name | 2-(2-hydroxyethylsulfinyl)ethanol |
| InChI | InChI=1S/C4H10O3S/c5-1-3-8(7)4-2-6/h5-6H,1-4H2 |
| InChIKey | XHKPPUVICXLDRJ-UHFFFAOYSA-N |
| SMILES | C(CS(=O)CCO)O |
| Reference | Sathe, M., et al.: Analyst, 139, 5118 (2014); Nie, Z., et al.: Guoji Yaoxue Yanjiu Zazhi, 38, 419 (2011); Ermakova, I. T., et al.: Microbiology, 71, 519 (2002) |
