For research use only. Not for therapeutic Use.
2,2′-Thiodisuccinic acid is an organosulfur compound with two succinic acid groups connected by a sulfur linkage, commonly used in biochemical and pharmaceutical research. Its structure allows it to act as a chelating agent and is valuable in developing compounds for metal-binding and catalytic studies. Additionally, it serves as a precursor for synthesizing biologically active molecules and coordination complexes. With its stability and functional versatility, 2,2′-Thiodisuccinic acid finds applications in drug discovery, materials science, and environmental research.
| Catalog Number | L020640 |
| CAS Number | 4917-76-4 |
| Molecular Formula | C8H10O8S |
| Purity | ≥95% |
| IUPAC Name | 2-(1,2-dicarboxyethylsulfanyl)butanedioic acid |
| InChI | InChI=1S/C8H10O8S/c9-5(10)1-3(7(13)14)17-4(8(15)16)2-6(11)12/h3-4H,1-2H2,(H,9,10)(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | SASYRHXVHLPMQD-UHFFFAOYSA-N |
| SMILES | C(C(C(=O)O)SC(CC(=O)O)C(=O)O)C(=O) |
