For research use only. Not for therapeutic Use.
2,2′,2”-(Benzene-1,3,5-triyl)triacetonitrile (Cat.No:L003491) is a crucial compound in organic synthesis. Its tricyclic aromatic structure and three acetonitrile groups confer unique reactivity and versatility. This compound finds application as a key intermediate in the synthesis of complex organic molecules. Its robust structure makes it valuable in the development of specialized materials.
CAS Number | 80935-59-7 |
Molecular Formula | C12H9N3 |
Purity | ≥95% |
IUPAC Name | 2-[3,5-bis(cyanomethyl)phenyl]acetonitrile |
InChI | InChI=1S/C12H9N3/c13-4-1-10-7-11(2-5-14)9-12(8-10)3-6-15/h7-9H,1-3H2 |
InChIKey | QEIMSNKURDQYSE-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1CC#N)CC#N)CC#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |