For research use only. Not for therapeutic Use.
2,2,2-Crypt (CAT: R044151) is a synthetic, cage-like polyether compound known for its ability to strongly bind metal cations through ion encapsulation. Its structure consists of three bridging oxygen atoms that form a cavity capable of trapping cations such as potassium, lithium, or sodium. This binding ability makes 2,2,2-Crypt valuable in fields like supramolecular chemistry, ion transport studies, and as a reagent for complexation reactions. It is widely used in research to stabilize unstable ions and facilitate selective ion exchange. Additionally, its ability to form stable complexes has applications in catalysis and materials science.
Catalog Number | R044151 |
CAS Number | 23978-09-8 |
Synonyms | 2,2,2-Cryptand; 2,2,2-Cryptate; Crypt-2,2,2; Cryptand 222; Cryptand C 222; Cryptand[2.2.2]; Cryptate 222; Cryptating agent 222; Cryptofix 222; K 222; Kryptand 222; Kryptofix 222; NSC 264495; [2,2,2]Crypand; USP Fludeoxyglucose Related Compound A; |
Molecular Formula | C18H36N2O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4,7,13,16,21,24-hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane |
InChI | InChI=1S/C18H36N2O6/c1-7-21-13-14-24-10-4-20-5-11-25-17-15-22-8-2-19(1)3-9-23-16-18-26-12-6-20/h1-18H2 |
InChIKey | AUFVJZSDSXXFOI-UHFFFAOYSA-N |
SMILES | C1COCCOCCN2CCOCCOCCN1CCOCCOCC2 |