For research use only. Not for therapeutic Use.
2,2,2-Trifluoro-1-(5-fluoropyridin-2-yl)ethanone(CAT: L033736) is a high-purity trifluoromethyl ketone compound widely used in pharmaceutical and chemical research. Featuring a fluorinated pyridine ring and a trifluoromethyl ketone functional group, this compound is a versatile intermediate in the synthesis of bioactive molecules and complex organic compounds. It is particularly valuable in medicinal chemistry for developing enzyme inhibitors, therapeutic agents, and fluorinated derivatives. With excellent stability and reactivity, 2,2,2-Trifluoro-1-(5-fluoropyridin-2-yl)ethanone ensures precision and reliability, making it an essential tool for advanced research and innovative synthetic applications.
CAS Number | 1060802-44-9 |
Molecular Formula | C7H3F4NO |
Purity | ≥95% |
IUPAC Name | 2,2,2-trifluoro-1-(5-fluoropyridin-2-yl)ethanone |
InChI | InChI=1S/C7H3F4NO/c8-4-1-2-5(12-3-4)6(13)7(9,10)11/h1-3H |
InChIKey | KYSDJZMUPMYVNZ-UHFFFAOYSA-N |
SMILES | C1=CC(=NC=C1F)C(=O)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |