For research use only. Not for therapeutic Use.
2,2,3,3-Tetrafluoropropyl p-toluenesulfonate(Cat No.:L017899)is a specialized chemical compound characterized by a tetrafluoropropyl group linked to a p-toluenesulfonate moiety. This structure offers significant chemical reactivity, particularly useful in organic synthesis for introducing fluorinated alkyl groups into other molecules. The presence of the fluorine atoms enhances the molecule’s stability and increases its lipophilicity, which can be critical in pharmaceutical applications to improve drug absorption and metabolic stability. 2,2,3,3-Tetrafluoropropyl p-toluenesulfonate is commonly used as a reagent in the synthesis of advanced materials and active pharmaceutical ingredients.
CAS Number | 786-31-2 |
Molecular Formula | C10H10F4O3S |
Purity | ≥95% |
IUPAC Name | 2,2,3,3-tetrafluoropropyl 4-methylbenzenesulfonate |
InChI | InChI=1S/C10H10F4O3S/c1-7-2-4-8(5-3-7)18(15,16)17-6-10(13,14)9(11)12/h2-5,9H,6H2,1H3 |
InChIKey | IMDNPHAMGJIKNV-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C(F)F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |