Home
>
Chemical Reagents>Organic Building Blocks> 2,2',3,3'-Tetrahydro-1,1'-spirobi[indene]-7,7'-diol
For research use only. Not for therapeutic Use.
2,2′,3,3′-Tetrahydro-1,1′-spirobi[indene]-7,7′-diol(Cat No.:L006882), is a complex organic compound used in pharmaceutical and medicinal chemistry research. Its molecular structure comprises a spirobifluorene core with hydroxy groups at the 7th and 7th positions. This compound is of interest to researchers due to its unique structure, making it a potential scaffold for the development of new drugs. Scientists utilize it to explore structure-activity relationships and design molecules with specific biological activities.
CAS Number | 223259-62-9 |
Molecular Formula | C17H16O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
InChI | InChI=1S/C17H16O2/c18-13-5-1-3-11-7-9-17(15(11)13)10-8-12-4-2-6-14(19)16(12)17/h1-6,18-19H,7-10H2 |
InChIKey | YBRDFCQKQVTQKX-UHFFFAOYSA-N |
SMILES | C1CC2(CCC3=C2C(=CC=C3)O)C4=C1C=CC=C4O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |