For research use only. Not for therapeutic Use.
2,2,4-Trimethyl-1,3-pentanediol Diisobutyrate (Cat.No:R016379) is a chemical compound commonly used as a plasticizer in various industries, particularly in the production of coatings, adhesives, and inks. It enhances the flexibility and durability of these materials. Additionally, it can serve as a solvent and viscosity reducer, improving the overall performance of the final products.
CAS Number | 6846-50-0 |
Synonyms | 2,2,4-Trimethyl-1,3-pentanediol Diisobutyrate; 2,2,4-Trimethyl-1,3-pentanediyl Diisobutyrate; CS 16; Eastman TXIB; Kodaflex TXIB; Kyowanol D; Kyowanol M; Optifilm Enhancer 300; TXIB; Texanol Isobutyrate; 2-Methylpropanoic Acid 2,2-Dimethyl-1-(1-meth |
Molecular Formula | C16H30O4 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | [2,2,4-trimethyl-3-(2-methylpropanoyloxy)pentyl] 2-methylpropanoate |
InChI | InChI=1S/C16H30O4/c1-10(2)13(20-15(18)12(5)6)16(7,8)9-19-14(17)11(3)4/h10-13H,9H2,1-8H3 |
InChIKey | OMVSWZDEEGIJJI-UHFFFAOYSA-N |
SMILES | CC(C)C(C(C)(C)COC(=O)C(C)C)OC(=O)C(C)C |