For research use only. Not for therapeutic Use.
2,2’,4,4’,5,5’-Hexachlorobiphenyl is a polychlorinated biphenyl (PCB) compound known for its persistence and toxicity in the environment. Used historically in electrical equipment and industrial applications, it is now a significant pollutant. Its stability and lipophilicity lead to bioaccumulation, posing health risks to wildlife and humans. Research focuses on its environmental impact and strategies for remediation and risk reduction.
CAS Number | 35065-27-1 |
Synonyms | 2,2’,4,4’,5,5’-Hexachloro-1,1’-biphenyl; 2,4,5,2’,4’,5’-Hexachlorobiphenyl; CB 153; K 153; PCB 153 |
Molecular Formula | C12H4Cl6 |
Purity | ≥95% |
Documentation | |
Storage | -20°C |
IUPAC Name | 1,2,4-trichloro-5-(2,4,5-trichlorophenyl)benzene |
InChI | InChI=1S/C12H4Cl6/c13-7-3-11(17)9(15)1-5(7)6-2-10(16)12(18)4-8(6)14/h1-4H |
InChIKey | MVWHGTYKUMDIHL-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)C2=CC(=C(C=C2Cl)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |