For research use only. Not for therapeutic Use.
2,2′:6′,2”-Terpyridine-4′-carboxylic acid（Cat No.:M104422）is a heterocyclic compound used in coordination chemistry, materials science, and pharmaceutical research. This molecule features a terpyridine core with a carboxylic acid group at the 4′-position, making it a versatile ligand for forming metal complexes. It is often employed in the synthesis of coordination compounds with potential applications in catalysis, molecular electronics, and drug development. The carboxylic acid functionality allows for further chemical modifications, making it a valuable building block in advanced material design and medicinal chemistry.
| Catalog Number | M104422 |
| CAS Number | 148332-36-9 |
| Molecular Formula | C16H11N3O2 |
| Purity | ≥95% |
| IUPAC Name | 2,6-dipyridin-2-ylpyridine-4-carboxylic acid |
| InChI | InChI=1S/C16H11N3O2/c20-16(21)11-9-14(12-5-1-3-7-17-12)19-15(10-11)13-6-2-4-8-18-13/h1-10H,(H,20,21) |
| InChIKey | ZYTWXMBGOUJDHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C(=O)O |
