For research use only. Not for therapeutic Use.
2,2,6,6-Tetrachlorocyclohexan-1-one(Cat No.:L006792). It features a cyclohexanone ring substituted with chlorine atoms at the 2, 2, 6, and 6 positions. This compound is vital in organic synthesis and environmental chemistry. Its unique structure makes it valuable as a precursor in the production of various chemicals and pesticides. Additionally, it has been studied for its environmental persistence and impact. Researchers explore its behavior in ecosystems and its potential health effects, contributing to our understanding of chlorinated organic compounds in the environment.
CAS Number | 3776-30-5 |
Molecular Formula | C6H6Cl4O |
Purity | ≥95% |
IUPAC Name | 2,2,6,6-tetrachlorocyclohexan-1-one |
InChI | InChI=1S/C6H6Cl4O/c7-5(8)2-1-3-6(9,10)4(5)11/h1-3H2 |
InChIKey | QCAHVKJGHYVLIS-UHFFFAOYSA-N |
SMILES | C1CC(C(=O)C(C1)(Cl)Cl)(Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |