For research use only. Not for therapeutic Use.
23-(9-Mercaptononyl)-3,6,9,12,15,18,21-heptaoxatricosanoic acid(Cat No.:R001611) is a compound with a long molecular chain consisting of 23 carbon atoms, seven oxygen atoms, and a thiol (sulfhydryl) group attached to a nonyl (nine-carbon) chain. This compound is often used in chemical synthesis and research due to its unique structure and properties. Its long hydrocarbon chain and sulfur-containing functional group make it useful in various applications, including as a surfactant, lubricant, or in the synthesis of polymers and other organic compounds.
CAS Number | 221222-49-7 |
Synonyms | 3,6,9,12,15,18,21-Heptaoxa-32-mercapto-dotriacontanoic Acid; 32-Mercapto-3,6,9,12,15,18,21-heptaoxadotriacontanoic Acid; [2-[2-[2-[2-[2-[2-[(11-Mercaptoundecyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic Acid; |
Molecular Formula | C25H50O9S |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(11-sulfanylundecoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
InChI | InChI=1S/C25H50O9S/c26-25(27)24-34-22-21-33-20-19-32-18-17-31-16-15-30-14-13-29-12-11-28-10-8-6-4-2-1-3-5-7-9-23-35/h35H,1-24H2,(H,26,27) |
InChIKey | XMVZGUSQWSVPNT-UHFFFAOYSA-N |
SMILES | C(CCCCCOCCOCCOCCOCCOCCOCCOCC(=O)O)CCCCCS |