For research use only. Not for therapeutic Use.
2,3-Butanedione-d6 (Major)(Cat No.:R059400) is a deuterated variant of 2,3-Butanedione, where six hydrogen atoms are predominantly replaced with deuterium. This isotopic enhancement significantly improves its stability and resistance to exchange reactions, making it highly valuable for detailed spectroscopic studies, particularly in flavor chemistry and food science. 2,3-Butanedione, commonly known as diacetyl, imparts a buttery flavor to foods and is also studied for its effects on respiratory health in occupational settings.
Catalog Number | R059400 |
CAS Number | 22026-37-5 |
Synonyms | 2,3-Butadione-d6; 2,3-Diketobutane-d6; 2,3-Dioxobutane-d6; Biacetyl-d6; Butanedione-d6; Diacetyl-d6; Dimethyl Diketone-d6; Dimethylglyoxal-d6; NSC 8750-d6; DA-d6; |
Molecular Formula | C4H6O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,1,1,4,4,4-hexadeuteriobutane-2,3-dione |
InChI | InChI=1S/C4H6O2/c1-3(5)4(2)6/h1-2H3/i1D3,2D3 |
InChIKey | QSJXEFYPDANLFS-WFGJKAKNSA-N |
SMILES | [2H]C([2H])([2H])C(=O)C(=O)C([2H])([2H])[2H] |